C18H22O3 — CID 23147031
4-ethyl-5-(2-methoxyethyl)-6-(3-methylphenyl)benzene-1,3-diol (PubChem CID 23147031) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-ethyl-5-(2-methoxyethyl)-6-(3-methylphenyl)benzene-1,3-diol.
| Compound Name | 4-ethyl-5-(2-methoxyethyl)-6-(3-methylphenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 23147031 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 4-ethyl-5-(2-methoxyethyl)-6-(3-methylphenyl)benzene-1,3-diol |
| SMILES | CCc1c(O)cc(O)c(-c2cccc(C)c2)c1CCOC |
| InChI | InChI=1S/C18H22O3/c1-4-14-15(8-9-21-3)18(17(20)11-16(14)19)13-7-5-6-12(2)10-13/h5-7,10-11,19-20H,4,8-9H2,1-3H3 |
| InChIKey | BXPMVALYNAFWMD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |