C25H29NO6 — CID 23147569
5-[2-(2,3-dihydroxypropoxy)ethyl]-4-ethyl-6-[3-(pyridin-2-ylmethoxy)phenyl]benzene-1,3-diol (PubChem CID 23147569) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 5-[2-(2,3-dihydroxypropoxy)ethyl]-4-ethyl-6-[3-(pyridin-2-ylmethoxy)phenyl]benzene-1,3-diol.
| Compound Name | 5-[2-(2,3-dihydroxypropoxy)ethyl]-4-ethyl-6-[3-(pyridin-2-ylmethoxy)phenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 23147569 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 5-[2-(2,3-dihydroxypropoxy)ethyl]-4-ethyl-6-[3-(pyridin-2-ylmethoxy)phenyl]benzene-1,3-diol |
| SMILES | CCc1c(O)cc(O)c(-c2cccc(OCc3ccccn3)c2)c1CCOCC(O)CO |
| InChI | InChI=1S/C25H29NO6/c1-2-21-22(9-11-31-16-19(28)14-27)25(24(30)13-23(21)29)17-6-5-8-20(12-17)32-15-18-7-3-4-10-26-18/h3-8,10,12-13,19,27-30H,2,9,11,14-16H2,1H3 |
| InChIKey | GYPSJZQGSUHSFX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|