C26H30N2O3 — CID 55901621
4-(2-phenylethoxy)-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]butanamide (PubChem CID 55901621) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-(2-phenylethoxy)-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]butanamide.
| Compound Name | 4-(2-phenylethoxy)-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 55901621 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 4-(2-phenylethoxy)-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]butanamide |
| SMILES | CC(NC(=O)CCCOCCc1ccccc1)c1cccc(OCc2ccccn2)c1 |
| InChI | InChI=1S/C26H30N2O3/c1-21(23-11-7-13-25(19-23)31-20-24-12-5-6-16-27-24)28-26(29)14-8-17-30-18-15-22-9-3-2-4-10-22/h2-7,9-13,16,19,21H,8,14-15,17-18,20H2,1H3,(H,28,29) |
| InChIKey | KGKMZTZEZATBCD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|