C25H35N3O3 — CID 56545254
N',N'-dipropyl-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]pentanediamide (PubChem CID 56545254) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is N',N'-dipropyl-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]pentanediamide.
| Compound Name | N',N'-dipropyl-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]pentanediamide |
|---|---|
| PubChem CID | 56545254 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N',N'-dipropyl-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]pentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NC(C)c1cccc(OCc2ccccn2)c1 |
| InChI | InChI=1S/C25H35N3O3/c1-4-16-28(17-5-2)25(30)14-9-13-24(29)27-20(3)21-10-8-12-23(18-21)31-19-22-11-6-7-15-26-22/h6-8,10-12,15,18,20H,4-5,9,13-14,16-17,19H2,1-3H3,(H,27,29) |
| InChIKey | NIUMWQJTSCVVNK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |