C21H19IN2O2 — CID 55901485
4-iodo-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide (PubChem CID 55901485) has the molecular formula C21H19IN2O2 and a molecular weight of 458.30 g/mol. Its IUPAC name is 4-iodo-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide.
| Compound Name | 4-iodo-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 55901485 |
| Molecular Formula | C21H19IN2O2 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 4-iodo-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(I)cc1)c1cccc(OCc2ccccn2)c1 |
| InChI | InChI=1S/C21H19IN2O2/c1-15(24-21(25)16-8-10-18(22)11-9-16)17-5-4-7-20(13-17)26-14-19-6-2-3-12-23-19/h2-13,15H,14H2,1H3,(H,24,25) |
| InChIKey | ULKVGWGVMYLHBV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|