C24H24N4O4S — CID 55958532
4-(2-cyanoethylsulfamoyl)-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide (PubChem CID 55958532) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 4-(2-cyanoethylsulfamoyl)-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide.
| Compound Name | 4-(2-cyanoethylsulfamoyl)-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 55958532 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 4-(2-cyanoethylsulfamoyl)-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(S(=O)(=O)NCCC#N)cc1)c1cccc(OCc2ccccn2)c1 |
| InChI | InChI=1S/C24H24N4O4S/c1-18(20-6-4-8-22(16-20)32-17-21-7-2-3-14-26-21)28-24(29)19-9-11-23(12-10-19)33(30,31)27-15-5-13-25/h2-4,6-12,14,16,18,27H,5,15,17H2,1H3,(H,28,29) |
| InChIKey | XOUVTCSSPKQDIY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|