C22H30N4O3 — CID 47065984
N-butan-2-yl-3-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethylcarbamoylamino]propanamide (PubChem CID 47065984) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-butan-2-yl-3-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethylcarbamoylamino]propanamide.
| Compound Name | N-butan-2-yl-3-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 47065984 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-butan-2-yl-3-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethylcarbamoylamino]propanamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)NC(C)c1cccc(OCc2ccccn2)c1 |
| InChI | InChI=1S/C22H30N4O3/c1-4-16(2)25-21(27)11-13-24-22(28)26-17(3)18-8-7-10-20(14-18)29-15-19-9-5-6-12-23-19/h5-10,12,14,16-17H,4,11,13,15H2,1-3H3,(H,25,27)(H2,24,26,28) |
| InChIKey | KVBSMCNDCQLNDL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |