C27H33N3O4S — CID 55902128
3-[4-(diethylsulfamoyl)phenyl]-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]propanamide (PubChem CID 55902128) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]propanamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 55902128 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)NC(C)c2cccc(OCc3ccccn3)c2)cc1 |
| InChI | InChI=1S/C27H33N3O4S/c1-4-30(5-2)35(32,33)26-15-12-22(13-16-26)14-17-27(31)29-21(3)23-9-8-11-25(19-23)34-20-24-10-6-7-18-28-24/h6-13,15-16,18-19,21H,4-5,14,17,20H2,1-3H3,(H,29,31) |
| InChIKey | GMNQPEPKKQSWIH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |