C19H26ClNO2 — CID 21280485
1-[3-(pyridin-2-ylmethoxy)phenyl]heptan-2-ol;hydrochloride (PubChem CID 21280485) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 1-[3-(pyridin-2-ylmethoxy)phenyl]heptan-2-ol;hydrochloride.
| Compound Name | 1-[3-(pyridin-2-ylmethoxy)phenyl]heptan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 21280485 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-[3-(pyridin-2-ylmethoxy)phenyl]heptan-2-ol;hydrochloride |
| SMILES | CCCCCC(O)Cc1cccc(OCc2ccccn2)c1.Cl |
| InChI | InChI=1S/C19H25NO2.ClH/c1-2-3-4-10-18(21)13-16-8-7-11-19(14-16)22-15-17-9-5-6-12-20-17;/h5-9,11-12,14,18,21H,2-4,10,13,15H2,1H3;1H |
| InChIKey | QNWJYDXRQUTZSN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|