C27H32O3 — CID 10982342
(2R)-1-[3,5-bis(phenylmethoxy)phenyl]heptan-2-ol (PubChem CID 10982342) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is (2R)-1-[3,5-bis(phenylmethoxy)phenyl]heptan-2-ol.
| Compound Name | (2R)-1-[3,5-bis(phenylmethoxy)phenyl]heptan-2-ol |
|---|---|
| PubChem CID | 10982342 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (2R)-1-[3,5-bis(phenylmethoxy)phenyl]heptan-2-ol |
| SMILES | CCCCC[C@@H](O)Cc1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H32O3/c1-2-3-6-15-25(28)16-24-17-26(29-20-22-11-7-4-8-12-22)19-27(18-24)30-21-23-13-9-5-10-14-23/h4-5,7-14,17-19,25,28H,2-3,6,15-16,20-21H2,1H3/t25-/m1/s1 |
| InChIKey | YDBGKMFERNWNMN-RUZDIDTESA-N |
| XLogP | 6.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|