C18H22O4 — CID 23147014
4-ethyl-5-(2-methoxyethyl)-6-(3-methoxyphenyl)benzene-1,3-diol (PubChem CID 23147014) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-ethyl-5-(2-methoxyethyl)-6-(3-methoxyphenyl)benzene-1,3-diol.
| Compound Name | 4-ethyl-5-(2-methoxyethyl)-6-(3-methoxyphenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 23147014 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-ethyl-5-(2-methoxyethyl)-6-(3-methoxyphenyl)benzene-1,3-diol |
| SMILES | CCc1c(O)cc(O)c(-c2cccc(OC)c2)c1CCOC |
| InChI | InChI=1S/C18H22O4/c1-4-14-15(8-9-21-2)18(17(20)11-16(14)19)12-6-5-7-13(10-12)22-3/h5-7,10-11,19-20H,4,8-9H2,1-3H3 |
| InChIKey | AZNSVBOSRUIYRY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |