C13H12O3 — CID 101299706
2-(4-hydroxyphenyl)-4-methylbenzene-1,3-diol (PubChem CID 101299706) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-4-methylbenzene-1,3-diol.
| Compound Name | 2-(4-hydroxyphenyl)-4-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 101299706 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2-(4-hydroxyphenyl)-4-methylbenzene-1,3-diol |
| SMILES | Cc1ccc(O)c(-c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C13H12O3/c1-8-2-7-11(15)12(13(8)16)9-3-5-10(14)6-4-9/h2-7,14-16H,1H3 |
| InChIKey | LLKSKDQVUYXUPX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |