C11H15F3NO2PS — CID 118475010
N-[butyl(phenyl)phosphanyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 118475010) has the molecular formula C11H15F3NO2PS and a molecular weight of 313.28 g/mol. Its IUPAC name is N-[butyl(phenyl)phosphanyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[butyl(phenyl)phosphanyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 118475010 |
| Molecular Formula | C11H15F3NO2PS |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[butyl(phenyl)phosphanyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCCCP(NS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H15F3NO2PS/c1-2-3-9-18(10-7-5-4-6-8-10)15-19(16,17)11(12,13)14/h4-8,15H,2-3,9H2,1H3 |
| InChIKey | PDPUIZQTTRARMK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|