C19H19NO — CID 129407853
(Z)-3-methoxy-2,6-diphenylhex-2-enenitrile (PubChem CID 129407853) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is (Z)-3-methoxy-2,6-diphenylhex-2-enenitrile.
| Compound Name | (Z)-3-methoxy-2,6-diphenylhex-2-enenitrile |
|---|---|
| PubChem CID | 129407853 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (Z)-3-methoxy-2,6-diphenylhex-2-enenitrile |
| SMILES | CO/C(CCCc1ccccc1)=C(\C#N)c1ccccc1 |
| InChI | InChI=1S/C19H19NO/c1-21-19(14-8-11-16-9-4-2-5-10-16)18(15-20)17-12-6-3-7-13-17/h2-7,9-10,12-13H,8,11,14H2,1H3/b19-18+ |
| InChIKey | YMKSGUHZCHWSDE-VHEBQXMUSA-N |
| XLogP | 4.59 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|