C15H29N2O2P — CID 118250736
3-[[di(propan-2-yl)amino]-hex-5-ynyl-dihydroxy-λ5-phosphanyl]propanenitrile (PubChem CID 118250736) has the molecular formula C15H29N2O2P and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-hex-5-ynyl-dihydroxy-λ5-phosphanyl]propanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-hex-5-ynyl-dihydroxy-λ5-phosphanyl]propanenitrile |
|---|---|
| PubChem CID | 118250736 |
| Molecular Formula | C15H29N2O2P |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-hex-5-ynyl-dihydroxy-λ5-phosphanyl]propanenitrile |
| SMILES | C#CCCCCP(O)(O)(CCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H29N2O2P/c1-6-7-8-9-12-20(18,19,13-10-11-16)17(14(2)3)15(4)5/h1,14-15,18-19H,7-10,12-13H2,2-5H3 |
| InChIKey | QHMBRTKKYYOSOE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|