C12H25N3O4P+ — CID 172766904
[(1S)-3-amino-1-(2-cyanoethoxy)-1,2-dihydroxypropyl]-[di(propan-2-yl)amino]-oxophosphanium (PubChem CID 172766904) has the molecular formula C12H25N3O4P+ and a molecular weight of 306.32 g/mol. Its IUPAC name is [(1S)-3-amino-1-(2-cyanoethoxy)-1,2-dihydroxypropyl]-[di(propan-2-yl)amino]-oxophosphanium.
| Compound Name | [(1S)-3-amino-1-(2-cyanoethoxy)-1,2-dihydroxypropyl]-[di(propan-2-yl)amino]-oxophosphanium |
|---|---|
| PubChem CID | 172766904 |
| Molecular Formula | C12H25N3O4P+ |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [(1S)-3-amino-1-(2-cyanoethoxy)-1,2-dihydroxypropyl]-[di(propan-2-yl)amino]-oxophosphanium |
| SMILES | CC(C)N(C(C)C)[P+](=O)[C@@](O)(OCCC#N)C(O)CN |
| InChI | InChI=1S/C12H25N3O4P/c1-9(2)15(10(3)4)20(18)12(17,11(16)8-14)19-7-5-6-13/h9-11,16-17H,5,7-8,14H2,1-4H3/q+1/t11?,12-/m0/s1 |
| InChIKey | VHBHKBQVZZOVPT-KIYNQFGBSA-N |
| XLogP | 0.74 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|