C13H28N3O3P — CID 175400165
3-[2-(aminomethyl)-1-[di(propan-2-yl)amino]phosphanyl-1,3-dihydroxypropoxy]propanenitrile (PubChem CID 175400165) has the molecular formula C13H28N3O3P and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-1-[di(propan-2-yl)amino]phosphanyl-1,3-dihydroxypropoxy]propanenitrile.
| Compound Name | 3-[2-(aminomethyl)-1-[di(propan-2-yl)amino]phosphanyl-1,3-dihydroxypropoxy]propanenitrile |
|---|---|
| PubChem CID | 175400165 |
| Molecular Formula | C13H28N3O3P |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 3-[2-(aminomethyl)-1-[di(propan-2-yl)amino]phosphanyl-1,3-dihydroxypropoxy]propanenitrile |
| SMILES | CC(C)N(PC(O)(OCCC#N)C(CN)CO)C(C)C |
| InChI | InChI=1S/C13H28N3O3P/c1-10(2)16(11(3)4)20-13(18,12(8-15)9-17)19-7-5-6-14/h10-12,17-18,20H,5,7-9,15H2,1-4H3 |
| InChIKey | MRYIXIZZKCOEPU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|