About 2-cyanoethyl 2-phenylpropanoate
2-cyanoethyl 2-phenylpropanoate (PubChem CID 172839466) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-cyanoethyl 2-phenylpropanoate.
Molecular Properties
| Compound Name | 2-cyanoethyl 2-phenylpropanoate |
| PubChem CID | 172839466 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-cyanoethyl 2-phenylpropanoate |
| SMILES | CC(C(=O)OCCC#N)c1ccccc1 |
| InChI | InChI=1S/C12H13NO2/c1-10(11-6-3-2-4-7-11)12(14)15-9-5-8-13/h2-4,6-7,10H,5,9H2,1H3 |
| InChIKey | WPGIQEDKGAPUFM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl 2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl 2-phenylpropanoate?
The IUPAC name of 2-cyanoethyl 2-phenylpropanoate (CID 172839466) is 2-cyanoethyl 2-phenylpropanoate.
What is the SMILES notation for 2-cyanoethyl 2-phenylpropanoate?
The canonical SMILES for 2-cyanoethyl 2-phenylpropanoate is CC(C(=O)OCCC#N)c1ccccc1.
What is the InChIKey of 2-cyanoethyl 2-phenylpropanoate?
The InChIKey is WPGIQEDKGAPUFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-10(11-6-3-2-4-7-11)12(14)15-9-5-8-13/h2-4,6-7,10H,5,9H2,1H3.
What are the key properties of 2-cyanoethyl 2-phenylpropanoate?
2-cyanoethyl 2-phenylpropanoate has a molecular weight of 203.24 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl 2-phenylpropanoate is sourced from PubChem (CID 172839466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).