C12H25N2O4P — CID 175760820
3-[(1S)-2-amino-1-di(propan-2-yl)phosphoryl-1,3-dihydroxypropoxy]propanenitrile (PubChem CID 175760820) has the molecular formula C12H25N2O4P and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-[(1S)-2-amino-1-di(propan-2-yl)phosphoryl-1,3-dihydroxypropoxy]propanenitrile.
| Compound Name | 3-[(1S)-2-amino-1-di(propan-2-yl)phosphoryl-1,3-dihydroxypropoxy]propanenitrile |
|---|---|
| PubChem CID | 175760820 |
| Molecular Formula | C12H25N2O4P |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 3-[(1S)-2-amino-1-di(propan-2-yl)phosphoryl-1,3-dihydroxypropoxy]propanenitrile |
| SMILES | CC(C)P(=O)(C(C)C)[C@@](O)(OCCC#N)C(N)CO |
| InChI | InChI=1S/C12H25N2O4P/c1-9(2)19(17,10(3)4)12(16,11(14)8-15)18-7-5-6-13/h9-11,15-16H,5,7-8,14H2,1-4H3/t11?,12-/m0/s1 |
| InChIKey | AGSARWQPQBYGDM-KIYNQFGBSA-N |
| XLogP | 1.06 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|