About 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate
1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate (PubChem CID 88616819) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate.
Molecular Properties
| Compound Name | 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate |
| PubChem CID | 88616819 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate |
| SMILES | CC(C)COC(=O)CCC(=O)OCCC#N |
| InChI | InChI=1S/C11H17NO4/c1-9(2)8-16-11(14)5-4-10(13)15-7-3-6-12/h9H,3-5,7-8H2,1-2H3 |
| InChIKey | XFIKPBXWUZETJQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate?
The IUPAC name of 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate (CID 88616819) is 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate.
What is the SMILES notation for 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate?
The canonical SMILES for 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate is CC(C)COC(=O)CCC(=O)OCCC#N.
What is the InChIKey of 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate?
The InChIKey is XFIKPBXWUZETJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c1-9(2)8-16-11(14)5-4-10(13)15-7-3-6-12/h9H,3-5,7-8H2,1-2H3.
What are the key properties of 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate?
1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate has a molecular weight of 227.26 g/mol, XLogP of 1.42, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-cyanoethyl) 4-O-(2-methylpropyl) butanedioate is sourced from PubChem (CID 88616819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).