C25H37N5O5 — CID 170011516
4-[2,3,4,5-tetrakis(3-cyanopropoxy)pentoxy]butanenitrile (PubChem CID 170011516) has the molecular formula C25H37N5O5 and a molecular weight of 487.60 g/mol. Its IUPAC name is 4-[2,3,4,5-tetrakis(3-cyanopropoxy)pentoxy]butanenitrile.
| Compound Name | 4-[2,3,4,5-tetrakis(3-cyanopropoxy)pentoxy]butanenitrile |
|---|---|
| PubChem CID | 170011516 |
| Molecular Formula | C25H37N5O5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 4-[2,3,4,5-tetrakis(3-cyanopropoxy)pentoxy]butanenitrile |
| SMILES | N#CCCCOCC(OCCCC#N)C(OCCCC#N)C(COCCCC#N)OCCCC#N |
| InChI | InChI=1S/C25H37N5O5/c26-11-1-6-16-31-21-23(33-18-8-3-13-28)25(35-20-10-5-15-30)24(34-19-9-4-14-29)22-32-17-7-2-12-27/h23-25H,1-10,16-22H2 |
| InChIKey | BFMGZXBKWICKSO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 165.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|