C9H16O10 — CID 90765048
(2R,3R,4R)-3,4,5-trihydroxy-2-[(2S,3R)-2,3,4-trihydroxybutanoyl]oxypentanoic acid (PubChem CID 90765048) has the molecular formula C9H16O10 and a molecular weight of 284.22 g/mol. Its IUPAC name is (2R,3R,4R)-3,4,5-trihydroxy-2-[(2S,3R)-2,3,4-trihydroxybutanoyl]oxypentanoic acid.
| Compound Name | (2R,3R,4R)-3,4,5-trihydroxy-2-[(2S,3R)-2,3,4-trihydroxybutanoyl]oxypentanoic acid |
|---|---|
| PubChem CID | 90765048 |
| Molecular Formula | C9H16O10 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (2R,3R,4R)-3,4,5-trihydroxy-2-[(2S,3R)-2,3,4-trihydroxybutanoyl]oxypentanoic acid |
| SMILES | O=C(O[C@@H](C(=O)O)[C@H](O)[C@H](O)CO)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H16O10/c10-1-3(12)5(14)7(8(16)17)19-9(18)6(15)4(13)2-11/h3-7,10-15H,1-2H2,(H,16,17)/t3-,4-,5-,6+,7-/m1/s1 |
| InChIKey | JUHGQYVZIICMTJ-BNWJMWRWSA-N |
| XLogP | -4.59 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |