C11H24N2O7 — CID 87253984
2,6-diaminohexanoic acid;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 87253984) has the molecular formula C11H24N2O7 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | 2,6-diaminohexanoic acid;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 87253984 |
| Molecular Formula | C11H24N2O7 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2,6-diaminohexanoic acid;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | NCCCCC(N)C(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H14N2O2.C5H10O5/c7-4-2-1-3-5(8)6(9)10;6-1-3(8)5(10)4(9)2-7/h5H,1-4,7-8H2,(H,9,10);1,3-5,7-10H,2H2/t;3-,4+,5+/m.0/s1 |
| InChIKey | GBWARTHIRIVTNI-KYWOWLQSSA-N |
| XLogP | -3.21 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|