C8H18N2O3 — CID 87191323
acetaldehyde;(2S)-2,6-diaminohexanoic acid (PubChem CID 87191323) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is acetaldehyde;(2S)-2,6-diaminohexanoic acid.
| Compound Name | acetaldehyde;(2S)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 87191323 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | acetaldehyde;(2S)-2,6-diaminohexanoic acid |
| SMILES | CC=O.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2.C2H4O/c7-4-2-1-3-5(8)6(9)10;1-2-3/h5H,1-4,7-8H2,(H,9,10);2H,1H3/t5-;/m0./s1 |
| InChIKey | UIYSCVVVCYQOOJ-JEDNCBNOSA-N |
| XLogP | -0.27 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|