About bis(1-hydroxybutyl) hexanedioate
bis(1-hydroxybutyl) hexanedioate (PubChem CID 88811322) has the molecular formula C14H26O6
and a molecular weight of 290.36 g/mol. Its IUPAC name is bis(1-hydroxybutyl) hexanedioate.
Molecular Properties
| Compound Name | bis(1-hydroxybutyl) hexanedioate |
| PubChem CID | 88811322 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | bis(1-hydroxybutyl) hexanedioate |
| SMILES | CCCC(O)OC(=O)CCCCC(=O)OC(O)CCC |
| InChI | InChI=1S/C14H26O6/c1-3-7-11(15)19-13(17)9-5-6-10-14(18)20-12(16)8-4-2/h11-12,15-16H,3-10H2,1-2H3 |
| InChIKey | IGLOZPXNWHMOEB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(1-hydroxybutyl) hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-hydroxybutyl) hexanedioate?
The IUPAC name of bis(1-hydroxybutyl) hexanedioate (CID 88811322) is bis(1-hydroxybutyl) hexanedioate.
What is the SMILES notation for bis(1-hydroxybutyl) hexanedioate?
The canonical SMILES for bis(1-hydroxybutyl) hexanedioate is CCCC(O)OC(=O)CCCCC(=O)OC(O)CCC.
What is the InChIKey of bis(1-hydroxybutyl) hexanedioate?
The InChIKey is IGLOZPXNWHMOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O6/c1-3-7-11(15)19-13(17)9-5-6-10-14(18)20-12(16)8-4-2/h11-12,15-16H,3-10H2,1-2H3.
What are the key properties of bis(1-hydroxybutyl) hexanedioate?
bis(1-hydroxybutyl) hexanedioate has a molecular weight of 290.36 g/mol, XLogP of 1.87, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-hydroxybutyl) hexanedioate is sourced from PubChem (CID 88811322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).