About 1-hydroxybutyl 3-oxobutanoate
1-hydroxybutyl 3-oxobutanoate (PubChem CID 19891073) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-hydroxybutyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 1-hydroxybutyl 3-oxobutanoate |
| PubChem CID | 19891073 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 1-hydroxybutyl 3-oxobutanoate |
| SMILES | CCCC(O)OC(=O)CC(C)=O |
| InChI | InChI=1S/C8H14O4/c1-3-4-7(10)12-8(11)5-6(2)9/h7,10H,3-5H2,1-2H3 |
| InChIKey | MKYZRENZWFPNDV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxybutyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxybutyl 3-oxobutanoate?
The IUPAC name of 1-hydroxybutyl 3-oxobutanoate (CID 19891073) is 1-hydroxybutyl 3-oxobutanoate.
What is the SMILES notation for 1-hydroxybutyl 3-oxobutanoate?
The canonical SMILES for 1-hydroxybutyl 3-oxobutanoate is CCCC(O)OC(=O)CC(C)=O.
What is the InChIKey of 1-hydroxybutyl 3-oxobutanoate?
The InChIKey is MKYZRENZWFPNDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-3-4-7(10)12-8(11)5-6(2)9/h7,10H,3-5H2,1-2H3.
What are the key properties of 1-hydroxybutyl 3-oxobutanoate?
1-hydroxybutyl 3-oxobutanoate has a molecular weight of 174.20 g/mol, XLogP of 0.63, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxybutyl 3-oxobutanoate is sourced from PubChem (CID 19891073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).