About 1-hydroxypropyl tetradecanoate
1-hydroxypropyl tetradecanoate (PubChem CID 20514336) has the molecular formula C17H34O3
and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-hydroxypropyl tetradecanoate.
Molecular Properties
| Compound Name | 1-hydroxypropyl tetradecanoate |
| PubChem CID | 20514336 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 1-hydroxypropyl tetradecanoate |
| SMILES | CCCCCCCCCCCCCC(=O)OC(O)CC |
| InChI | InChI=1S/C17H34O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-17(19)20-16(18)4-2/h16,18H,3-15H2,1-2H3 |
| InChIKey | YJIOVIZPHMGNOI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypropyl tetradecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropyl tetradecanoate?
The IUPAC name of 1-hydroxypropyl tetradecanoate (CID 20514336) is 1-hydroxypropyl tetradecanoate.
What is the SMILES notation for 1-hydroxypropyl tetradecanoate?
The canonical SMILES for 1-hydroxypropyl tetradecanoate is CCCCCCCCCCCCCC(=O)OC(O)CC.
What is the InChIKey of 1-hydroxypropyl tetradecanoate?
The InChIKey is YJIOVIZPHMGNOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-17(19)20-16(18)4-2/h16,18H,3-15H2,1-2H3.
What are the key properties of 1-hydroxypropyl tetradecanoate?
1-hydroxypropyl tetradecanoate has a molecular weight of 286.46 g/mol, XLogP of 4.96, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropyl tetradecanoate is sourced from PubChem (CID 20514336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).