C20H42O9 — CID 19805212
1-hydroxybutyl hexanoate;2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 19805212) has the molecular formula C20H42O9 and a molecular weight of 426.55 g/mol. Its IUPAC name is 1-hydroxybutyl hexanoate;2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 1-hydroxybutyl hexanoate;2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 19805212 |
| Molecular Formula | C20H42O9 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 1-hydroxybutyl hexanoate;2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CCCCCC(=O)OC(O)CCC.OCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C10H22O6.C10H20O3/c11-1-3-13-5-7-15-9-10-16-8-6-14-4-2-12;1-3-5-6-8-10(12)13-9(11)7-4-2/h11-12H,1-10H2;9,11H,3-8H2,1-2H3 |
| InChIKey | KYKUGOKMVWGRIE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|