C16H32O5 — CID 174716237
2-(2-hydroxyethoxy)ethyl dodecaneperoxoate (PubChem CID 174716237) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl dodecaneperoxoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl dodecaneperoxoate |
|---|---|
| PubChem CID | 174716237 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl dodecaneperoxoate |
| SMILES | CCCCCCCCCCCC(=O)OOCCOCCO |
| InChI | InChI=1S/C16H32O5/c1-2-3-4-5-6-7-8-9-10-11-16(18)21-20-15-14-19-13-12-17/h17H,2-15H2,1H3 |
| InChIKey | FDRJSGDRNPLHMC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|