About 2-hydroxyethyl octadecaneperoxoate
2-hydroxyethyl octadecaneperoxoate (PubChem CID 87676050) has the molecular formula C20H40O4
and a molecular weight of 344.54 g/mol. Its IUPAC name is 2-hydroxyethyl octadecaneperoxoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl octadecaneperoxoate |
| PubChem CID | 87676050 |
| Molecular Formula | C20H40O4 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 2-hydroxyethyl octadecaneperoxoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OOCCO |
| InChI | InChI=1S/C20H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)24-23-19-18-21/h21H,2-19H2,1H3 |
| InChIKey | ONSIKMLTODWCLY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl octadecaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl octadecaneperoxoate?
The IUPAC name of 2-hydroxyethyl octadecaneperoxoate (CID 87676050) is 2-hydroxyethyl octadecaneperoxoate.
What is the SMILES notation for 2-hydroxyethyl octadecaneperoxoate?
The canonical SMILES for 2-hydroxyethyl octadecaneperoxoate is CCCCCCCCCCCCCCCCCC(=O)OOCCO.
What is the InChIKey of 2-hydroxyethyl octadecaneperoxoate?
The InChIKey is ONSIKMLTODWCLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)24-23-19-18-21/h21H,2-19H2,1H3.
What are the key properties of 2-hydroxyethyl octadecaneperoxoate?
2-hydroxyethyl octadecaneperoxoate has a molecular weight of 344.54 g/mol, XLogP of 5.72, 19 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl octadecaneperoxoate is sourced from PubChem (CID 87676050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).