C10H18O7 — CID 88844301
6-[2-(2-hydroxyethoxy)ethylperoxy]-6-oxohexanoic acid (PubChem CID 88844301) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is 6-[2-(2-hydroxyethoxy)ethylperoxy]-6-oxohexanoic acid.
| Compound Name | 6-[2-(2-hydroxyethoxy)ethylperoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 88844301 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 6-[2-(2-hydroxyethoxy)ethylperoxy]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)OOCCOCCO |
| InChI | InChI=1S/C10H18O7/c11-5-6-15-7-8-16-17-10(14)4-2-1-3-9(12)13/h11H,1-8H2,(H,12,13) |
| InChIKey | DFKULDCTYMRXHF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|