About 1,4-dihydroxybutyl carbonochloridate
1,4-dihydroxybutyl carbonochloridate (PubChem CID 91112318) has the molecular formula C5H9ClO4
and a molecular weight of 168.58 g/mol. Its IUPAC name is 1,4-dihydroxybutyl carbonochloridate.
Molecular Properties
| Compound Name | 1,4-dihydroxybutyl carbonochloridate |
| PubChem CID | 91112318 |
| Molecular Formula | C5H9ClO4 |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 1,4-dihydroxybutyl carbonochloridate |
| SMILES | O=C(Cl)OC(O)CCCO |
| InChI | InChI=1S/C5H9ClO4/c6-5(9)10-4(8)2-1-3-7/h4,7-8H,1-3H2 |
| InChIKey | UJEWDFCOQOZYGL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dihydroxybutyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroxybutyl carbonochloridate?
The IUPAC name of 1,4-dihydroxybutyl carbonochloridate (CID 91112318) is 1,4-dihydroxybutyl carbonochloridate.
What is the SMILES notation for 1,4-dihydroxybutyl carbonochloridate?
The canonical SMILES for 1,4-dihydroxybutyl carbonochloridate is O=C(Cl)OC(O)CCCO.
What is the InChIKey of 1,4-dihydroxybutyl carbonochloridate?
The InChIKey is UJEWDFCOQOZYGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO4/c6-5(9)10-4(8)2-1-3-7/h4,7-8H,1-3H2.
What are the key properties of 1,4-dihydroxybutyl carbonochloridate?
1,4-dihydroxybutyl carbonochloridate has a molecular weight of 168.58 g/mol, XLogP of 0.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroxybutyl carbonochloridate is sourced from PubChem (CID 91112318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).