C22H48O4SSn — CID 173453102
1,4-dihydroxybutyl 2-octyl-2-sulfanyldecanoate;stannane (PubChem CID 173453102) has the molecular formula C22H48O4SSn and a molecular weight of 527.40 g/mol. Its IUPAC name is 1,4-dihydroxybutyl 2-octyl-2-sulfanyldecanoate;stannane.
| Compound Name | 1,4-dihydroxybutyl 2-octyl-2-sulfanyldecanoate;stannane |
|---|---|
| PubChem CID | 173453102 |
| Molecular Formula | C22H48O4SSn |
| Molecular Weight | 527.40 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 1,4-dihydroxybutyl 2-octyl-2-sulfanyldecanoate;stannane |
| SMILES | CCCCCCCCC(S)(CCCCCCCC)C(=O)OC(O)CCCO.[SnH4] |
| InChI | InChI=1S/C22H44O4S.Sn.4H/c1-3-5-7-9-11-13-17-22(27,18-14-12-10-8-6-4-2)21(25)26-20(24)16-15-19-23;;;;;/h20,23-24,27H,3-19H2,1-2H3;;;;; |
| InChIKey | RNMZFRSUAZJERO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|