C24H44O4 — CID 140562104
1,6-dihydroxyhexyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 140562104) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is 1,6-dihydroxyhexyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 1,6-dihydroxyhexyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 140562104 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | 1,6-dihydroxyhexyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(O)CCCCCO |
| InChI | InChI=1S/C24H44O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23(26)28-24(27)21-18-16-19-22-25/h6-7,9-10,24-25,27H,2-5,8,11-22H2,1H3/b7-6-,10-9- |
| InChIKey | UPFFEHMLUKJHFL-HZJYTTRNSA-N |
| XLogP | 6.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|