C23H42O4 — CID 171477265
(1,3-dihydroxy-3-methylbutyl) (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 171477265) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is (1,3-dihydroxy-3-methylbutyl) (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | (1,3-dihydroxy-3-methylbutyl) (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 171477265 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | (1,3-dihydroxy-3-methylbutyl) (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(O)CC(C)(C)O |
| InChI | InChI=1S/C23H42O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(24)27-22(25)20-23(2,3)26/h8-9,11-12,22,25-26H,4-7,10,13-20H2,1-3H3/b9-8-,12-11- |
| InChIKey | YSLMPGBHPQARNG-MURFETPASA-N |
| XLogP | 5.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|