C34H66O6S3Sn — CID 139836559
[butyl-bis[(2-ethyl-2-sulfanyloctanoyl)oxy]stannyl] 2-ethyl-2-sulfanyloctanoate (PubChem CID 139836559) has the molecular formula C34H66O6S3Sn and a molecular weight of 785.81 g/mol. Its IUPAC name is [butyl-bis[(2-ethyl-2-sulfanyloctanoyl)oxy]stannyl] 2-ethyl-2-sulfanyloctanoate.
| Compound Name | [butyl-bis[(2-ethyl-2-sulfanyloctanoyl)oxy]stannyl] 2-ethyl-2-sulfanyloctanoate |
|---|---|
| PubChem CID | 139836559 |
| Molecular Formula | C34H66O6S3Sn |
| Molecular Weight | 785.81 g/mol |
| Exact Mass | 786.30 |
| IUPAC Name | [butyl-bis[(2-ethyl-2-sulfanyloctanoyl)oxy]stannyl] 2-ethyl-2-sulfanyloctanoate |
| SMILES | CCCCCCC(S)(CC)C(=O)O[Sn](CCCC)(OC(=O)C(S)(CC)CCCCCC)OC(=O)C(S)(CC)CCCCCC |
| InChI | InChI=1S/3C10H20O2S.C4H9.Sn/c3*1-3-5-6-7-8-10(13,4-2)9(11)12;1-3-4-2;/h3*13H,3-8H2,1-2H3,(H,11,12);1,3-4H2,2H3;/q;;;;+3/p-3 |
| InChIKey | KXAKENNYBLQHNZ-UHFFFAOYSA-K |
| XLogP | 10.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.81 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|