C28H56O4S2Sn — CID 18926728
dibutyltin(2+);bis(2-ethyl-2-sulfanyloctanoate) (PubChem CID 18926728) has the molecular formula C28H56O4S2Sn and a molecular weight of 639.60 g/mol. Its IUPAC name is dibutyltin(2+);bis(2-ethyl-2-sulfanyloctanoate).
| Compound Name | dibutyltin(2+);bis(2-ethyl-2-sulfanyloctanoate) |
|---|---|
| PubChem CID | 18926728 |
| Molecular Formula | C28H56O4S2Sn |
| Molecular Weight | 639.60 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | dibutyltin(2+);bis(2-ethyl-2-sulfanyloctanoate) |
| SMILES | CCCCCCC(S)(CC)C(=O)[O-].CCCCCCC(S)(CC)C(=O)[O-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/2C10H20O2S.2C4H9.Sn/c2*1-3-5-6-7-8-10(13,4-2)9(11)12;2*1-3-4-2;/h2*13H,3-8H2,1-2H3,(H,11,12);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | QEZUEBHBTCYJOV-UHFFFAOYSA-L |
| XLogP | 6.70 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|