About dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate)
dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate) (PubChem CID 88618271) has the molecular formula C36H72O4S2Sn
and a molecular weight of 751.81 g/mol. Its IUPAC name is dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate).
Molecular Properties
| Compound Name | dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate) |
| PubChem CID | 88618271 |
| Molecular Formula | C36H72O4S2Sn |
| Molecular Weight | 751.81 g/mol |
| Exact Mass | 752.39 |
| IUPAC Name | dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate) |
| SMILES | CCCCCCC(O)(CCCCCC)C(=O)[S-].CCCCCCC(O)(CCCCCC)C(=O)[S-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/2C14H28O2S.2C4H9.Sn/c2*1-3-5-7-9-11-14(16,13(15)17)12-10-8-6-4-2;2*1-3-4-2;/h2*16H,3-12H2,1-2H3,(H,15,17);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | MUGMQBYQHVHUTC-UHFFFAOYSA-L |
| XLogP | 10.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 751.81 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate)?
The IUPAC name of dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate) (CID 88618271) is dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate).
What is the SMILES notation for dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate)?
The canonical SMILES for dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate) is CCCCCCC(O)(CCCCCC)C(=O)[S-].CCCCCCC(O)(CCCCCC)C(=O)[S-].CCCC[Sn+2]CCCC.
What is the InChIKey of dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate)?
The InChIKey is MUGMQBYQHVHUTC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C14H28O2S.2C4H9.Sn/c2*1-3-5-7-9-11-14(16,13(15)17)12-10-8-6-4-2;2*1-3-4-2;/h2*16H,3-12H2,1-2H3,(H,15,17);2*1,3-4H2,2H3;/q;;;;+2/p-2.
What are the key properties of dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate)?
dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate) has a molecular weight of 751.81 g/mol, XLogP of 10.59, 28 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin(2+);bis(2-hexyl-2-hydroxyoctanethioate) is sourced from PubChem (CID 88618271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).