About dioctyltin(2+);propanethioate
dioctyltin(2+);propanethioate (PubChem CID 87846973) has the molecular formula C22H44O2S2Sn
and a molecular weight of 523.44 g/mol. Its IUPAC name is dioctyltin(2+);propanethioate.
Molecular Properties
| Compound Name | dioctyltin(2+);propanethioate |
| PubChem CID | 87846973 |
| Molecular Formula | C22H44O2S2Sn |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | dioctyltin(2+);propanethioate |
| SMILES | CCC(=O)[S-].CCC(=O)[S-].CCCCCCCC[Sn+2]CCCCCCCC |
| InChI | InChI=1S/2C8H17.2C3H6OS.Sn/c2*1-3-5-7-8-6-4-2;2*1-2-3(4)5;/h2*1,3-8H2,2H3;2*2H2,1H3,(H,4,5);/q;;;;+2/p-2 |
| InChIKey | IHIYOVLGBAUUPH-UHFFFAOYSA-L |
| XLogP | 7.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dioctyltin(2+);propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctyltin(2+);propanethioate?
The IUPAC name of dioctyltin(2+);propanethioate (CID 87846973) is dioctyltin(2+);propanethioate.
What is the SMILES notation for dioctyltin(2+);propanethioate?
The canonical SMILES for dioctyltin(2+);propanethioate is CCC(=O)[S-].CCC(=O)[S-].CCCCCCCC[Sn+2]CCCCCCCC.
What is the InChIKey of dioctyltin(2+);propanethioate?
The InChIKey is IHIYOVLGBAUUPH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H17.2C3H6OS.Sn/c2*1-3-5-7-8-6-4-2;2*1-2-3(4)5;/h2*1,3-8H2,2H3;2*2H2,1H3,(H,4,5);/q;;;;+2/p-2.
What are the key properties of dioctyltin(2+);propanethioate?
dioctyltin(2+);propanethioate has a molecular weight of 523.44 g/mol, XLogP of 7.19, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyltin(2+);propanethioate is sourced from PubChem (CID 87846973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).