About sodium decanethioate
sodium decanethioate (PubChem CID 87364523) has the molecular formula C10H19NaOS
and a molecular weight of 210.32 g/mol. Its IUPAC name is sodium decanethioate.
Molecular Properties
| Compound Name | sodium decanethioate |
| PubChem CID | 87364523 |
| Molecular Formula | C10H19NaOS |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | sodium decanethioate |
| SMILES | CCCCCCCCCC(=O)[S-].[Na+] |
| InChI | InChI=1S/C10H20OS.Na/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | ADIRXJSWUSBICR-UHFFFAOYSA-M |
| XLogP | 0.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium decanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium decanethioate?
The IUPAC name of sodium decanethioate (CID 87364523) is sodium decanethioate.
What is the SMILES notation for sodium decanethioate?
The canonical SMILES for sodium decanethioate is CCCCCCCCCC(=O)[S-].[Na+].
What is the InChIKey of sodium decanethioate?
The InChIKey is ADIRXJSWUSBICR-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20OS.Na/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+1/p-1.
What are the key properties of sodium decanethioate?
sodium decanethioate has a molecular weight of 210.32 g/mol, XLogP of 0.20, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium decanethioate is sourced from PubChem (CID 87364523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).