About potassium octanethioate
potassium octanethioate (PubChem CID 146161964) has the molecular formula C8H15KOS
and a molecular weight of 198.37 g/mol. Its IUPAC name is potassium octanethioate.
Molecular Properties
| Compound Name | potassium octanethioate |
| PubChem CID | 146161964 |
| Molecular Formula | C8H15KOS |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | potassium octanethioate |
| SMILES | CCCCCCCC(=O)[S-].[K+] |
| InChI | InChI=1S/C8H16OS.K/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+1/p-1 |
| InChIKey | SZXFJXYTMJRGHQ-UHFFFAOYSA-M |
| XLogP | -0.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze potassium octanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium octanethioate?
The IUPAC name of potassium octanethioate (CID 146161964) is potassium octanethioate.
What is the SMILES notation for potassium octanethioate?
The canonical SMILES for potassium octanethioate is CCCCCCCC(=O)[S-].[K+].
What is the InChIKey of potassium octanethioate?
The InChIKey is SZXFJXYTMJRGHQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16OS.K/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of potassium octanethioate?
potassium octanethioate has a molecular weight of 198.37 g/mol, XLogP of -0.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium octanethioate is sourced from PubChem (CID 146161964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).