About 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+)
2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+) (PubChem CID 21117141) has the molecular formula C22H42O4SSn
and a molecular weight of 521.35 g/mol. Its IUPAC name is 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+).
Molecular Properties
| Compound Name | 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+) |
| PubChem CID | 21117141 |
| Molecular Formula | C22H42O4SSn |
| Molecular Weight | 521.35 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+) |
| SMILES | CC(SC(C)C(=O)[O-])C(=O)[O-].CCCCCCCC[Sn+2]CCCCCCCC |
| InChI | InChI=1S/2C8H17.C6H10O4S.Sn/c2*1-3-5-7-8-6-4-2;1-3(5(7)8)11-4(2)6(9)10;/h2*1,3-8H2,2H3;3-4H,1-2H3,(H,7,8)(H,9,10);/q;;;+2/p-2 |
| InChIKey | DVILCPBXNZYRLN-UHFFFAOYSA-L |
| XLogP | 4.24 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 521.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+)?
The IUPAC name of 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+) (CID 21117141) is 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+).
What is the SMILES notation for 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+)?
The canonical SMILES for 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+) is CC(SC(C)C(=O)[O-])C(=O)[O-].CCCCCCCC[Sn+2]CCCCCCCC.
What is the InChIKey of 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+)?
The InChIKey is DVILCPBXNZYRLN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H17.C6H10O4S.Sn/c2*1-3-5-7-8-6-4-2;1-3(5(7)8)11-4(2)6(9)10;/h2*1,3-8H2,2H3;3-4H,1-2H3,(H,7,8)(H,9,10);/q;;;+2/p-2.
What are the key properties of 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+)?
2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+) has a molecular weight of 521.35 g/mol, XLogP of 4.24, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-carboxylatoethylsulfanyl)propanoate;dioctyltin(2+) is sourced from PubChem (CID 21117141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).