C17H33O8S- — CID 23332091
2,2-bis(hydroxymethyl)propane-1,3-diol;2-(1-hexoxy-1-oxopropan-2-yl)sulfanylpropanoate (PubChem CID 23332091) has the molecular formula C17H33O8S- and a molecular weight of 397.51 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;2-(1-hexoxy-1-oxopropan-2-yl)sulfanylpropanoate.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2-(1-hexoxy-1-oxopropan-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 23332091 |
| Molecular Formula | C17H33O8S- |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2-(1-hexoxy-1-oxopropan-2-yl)sulfanylpropanoate |
| SMILES | CCCCCCOC(=O)C(C)SC(C)C(=O)[O-].OCC(CO)(CO)CO |
| InChI | InChI=1S/C12H22O4S.C5H12O4/c1-4-5-6-7-8-16-12(15)10(3)17-9(2)11(13)14;6-1-5(2-7,3-8)4-9/h9-10H,4-8H2,1-3H3,(H,13,14);6-9H,1-4H2/p-1 |
| InChIKey | HMWXJZFCKOGJLY-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|