About dihexyltin(2+);bis(2-ethylhexanoate)
dihexyltin(2+);bis(2-ethylhexanoate) (PubChem CID 87140173) has the molecular formula C28H56O4Sn
and a molecular weight of 575.46 g/mol. Its IUPAC name is dihexyltin(2+);bis(2-ethylhexanoate).
Molecular Properties
| Compound Name | dihexyltin(2+);bis(2-ethylhexanoate) |
| PubChem CID | 87140173 |
| Molecular Formula | C28H56O4Sn |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | dihexyltin(2+);bis(2-ethylhexanoate) |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].CCCCCC[Sn+2]CCCCCC |
| InChI | InChI=1S/2C8H16O2.2C6H13.Sn/c2*1-3-5-6-7(4-2)8(9)10;2*1-3-5-6-4-2;/h2*7H,3-6H2,1-2H3,(H,9,10);2*1,3-6H2,2H3;/q;;;;+2/p-2 |
| InChIKey | LEXUOJCQUCVWQW-UHFFFAOYSA-L |
| XLogP | 6.59 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dihexyltin(2+);bis(2-ethylhexanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihexyltin(2+);bis(2-ethylhexanoate)?
The IUPAC name of dihexyltin(2+);bis(2-ethylhexanoate) (CID 87140173) is dihexyltin(2+);bis(2-ethylhexanoate).
What is the SMILES notation for dihexyltin(2+);bis(2-ethylhexanoate)?
The canonical SMILES for dihexyltin(2+);bis(2-ethylhexanoate) is CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].CCCCCC[Sn+2]CCCCCC.
What is the InChIKey of dihexyltin(2+);bis(2-ethylhexanoate)?
The InChIKey is LEXUOJCQUCVWQW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H16O2.2C6H13.Sn/c2*1-3-5-6-7(4-2)8(9)10;2*1-3-5-6-4-2;/h2*7H,3-6H2,1-2H3,(H,9,10);2*1,3-6H2,2H3;/q;;;;+2/p-2.
What are the key properties of dihexyltin(2+);bis(2-ethylhexanoate)?
dihexyltin(2+);bis(2-ethylhexanoate) has a molecular weight of 575.46 g/mol, XLogP of 6.59, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihexyltin(2+);bis(2-ethylhexanoate) is sourced from PubChem (CID 87140173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).