C7H15NO4 — CID 175399258
(3S)-2,3,7-trihydroxyheptanamide (PubChem CID 175399258) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3S)-2,3,7-trihydroxyheptanamide.
| Compound Name | (3S)-2,3,7-trihydroxyheptanamide |
|---|---|
| PubChem CID | 175399258 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (3S)-2,3,7-trihydroxyheptanamide |
| SMILES | NC(=O)C(O)[C@@H](O)CCCCO |
| InChI | InChI=1S/C7H15NO4/c8-7(12)6(11)5(10)3-1-2-4-9/h5-6,9-11H,1-4H2,(H2,8,12)/t5-,6?/m0/s1 |
| InChIKey | GBIZBDQZOYZPJN-ZBHICJROSA-N |
| XLogP | -1.64 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|