C16H31NaO5 — CID 23716744
sodium 9,10,16-trihydroxyhexadecanoate (PubChem CID 23716744) has the molecular formula C16H31NaO5 and a molecular weight of 326.41 g/mol. Its IUPAC name is sodium 9,10,16-trihydroxyhexadecanoate.
| Compound Name | sodium 9,10,16-trihydroxyhexadecanoate |
|---|---|
| PubChem CID | 23716744 |
| Molecular Formula | C16H31NaO5 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | sodium 9,10,16-trihydroxyhexadecanoate |
| SMILES | O=C([O-])CCCCCCCC(O)C(O)CCCCCCO.[Na+] |
| InChI | InChI=1S/C16H32O5.Na/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21;/h14-15,17-19H,1-13H2,(H,20,21);/q;+1/p-1 |
| InChIKey | LBASPWPFHMRUOS-UHFFFAOYSA-M |
| XLogP | -1.86 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|