C16H31O5- — CID 7269315
(9S,10R)-9,10,16-trihydroxyhexadecanoate (PubChem CID 7269315) has the molecular formula C16H31O5- and a molecular weight of 303.42 g/mol. Its IUPAC name is (9S,10R)-9,10,16-trihydroxyhexadecanoate.
| Compound Name | (9S,10R)-9,10,16-trihydroxyhexadecanoate |
|---|---|
| PubChem CID | 7269315 |
| Molecular Formula | C16H31O5- |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (9S,10R)-9,10,16-trihydroxyhexadecanoate |
| SMILES | O=C([O-])CCCCCCC[C@H](O)[C@H](O)CCCCCCO |
| InChI | InChI=1S/C16H32O5/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h14-15,17-19H,1-13H2,(H,20,21)/p-1/t14-,15+/m0/s1 |
| InChIKey | MEHUJCGAYMDLEL-LSDHHAIUSA-M |
| XLogP | 1.13 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|