C18H37NaO6 — CID 174758233
sodium;hydride;2,3,4,18-tetrahydroxyoctadecanoic acid (PubChem CID 174758233) has the molecular formula C18H37NaO6 and a molecular weight of 372.48 g/mol. Its IUPAC name is sodium;hydride;2,3,4,18-tetrahydroxyoctadecanoic acid.
| Compound Name | sodium;hydride;2,3,4,18-tetrahydroxyoctadecanoic acid |
|---|---|
| PubChem CID | 174758233 |
| Molecular Formula | C18H37NaO6 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | sodium;hydride;2,3,4,18-tetrahydroxyoctadecanoic acid |
| SMILES | O=C(O)C(O)C(O)C(O)CCCCCCCCCCCCCCO.[H-].[Na+] |
| InChI | InChI=1S/C18H36O6.Na.H/c19-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(20)16(21)17(22)18(23)24;;/h15-17,19-22H,1-14H2,(H,23,24);;/q;+1;-1 |
| InChIKey | MZUCPDARDLFANR-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|