About 7-hydroxyhept-1-en-4-yl carbamate
7-hydroxyhept-1-en-4-yl carbamate (PubChem CID 175099859) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 7-hydroxyhept-1-en-4-yl carbamate.
Molecular Properties
| Compound Name | 7-hydroxyhept-1-en-4-yl carbamate |
| PubChem CID | 175099859 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 7-hydroxyhept-1-en-4-yl carbamate |
| SMILES | C=CCC(CCCO)OC(N)=O |
| InChI | InChI=1S/C8H15NO3/c1-2-4-7(5-3-6-10)12-8(9)11/h2,7,10H,1,3-6H2,(H2,9,11) |
| InChIKey | RVDJOMIEXDDMHS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxyhept-1-en-4-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxyhept-1-en-4-yl carbamate?
The IUPAC name of 7-hydroxyhept-1-en-4-yl carbamate (CID 175099859) is 7-hydroxyhept-1-en-4-yl carbamate.
What is the SMILES notation for 7-hydroxyhept-1-en-4-yl carbamate?
The canonical SMILES for 7-hydroxyhept-1-en-4-yl carbamate is C=CCC(CCCO)OC(N)=O.
What is the InChIKey of 7-hydroxyhept-1-en-4-yl carbamate?
The InChIKey is RVDJOMIEXDDMHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-2-4-7(5-3-6-10)12-8(9)11/h2,7,10H,1,3-6H2,(H2,9,11).
What are the key properties of 7-hydroxyhept-1-en-4-yl carbamate?
7-hydroxyhept-1-en-4-yl carbamate has a molecular weight of 173.21 g/mol, XLogP of 0.80, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxyhept-1-en-4-yl carbamate is sourced from PubChem (CID 175099859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).