About bis(1-butoxyethyl) sulfate
bis(1-butoxyethyl) sulfate (PubChem CID 88713543) has the molecular formula C12H26O6S
and a molecular weight of 298.40 g/mol. Its IUPAC name is bis(1-butoxyethyl) sulfate.
Molecular Properties
| Compound Name | bis(1-butoxyethyl) sulfate |
| PubChem CID | 88713543 |
| Molecular Formula | C12H26O6S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | bis(1-butoxyethyl) sulfate |
| SMILES | CCCCOC(C)OS(=O)(=O)OC(C)OCCCC |
| InChI | InChI=1S/C12H26O6S/c1-5-7-9-15-11(3)17-19(13,14)18-12(4)16-10-8-6-2/h11-12H,5-10H2,1-4H3 |
| InChIKey | PZSNNMFZIZNQNT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(1-butoxyethyl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-butoxyethyl) sulfate?
The IUPAC name of bis(1-butoxyethyl) sulfate (CID 88713543) is bis(1-butoxyethyl) sulfate.
What is the SMILES notation for bis(1-butoxyethyl) sulfate?
The canonical SMILES for bis(1-butoxyethyl) sulfate is CCCCOC(C)OS(=O)(=O)OC(C)OCCCC.
What is the InChIKey of bis(1-butoxyethyl) sulfate?
The InChIKey is PZSNNMFZIZNQNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O6S/c1-5-7-9-15-11(3)17-19(13,14)18-12(4)16-10-8-6-2/h11-12H,5-10H2,1-4H3.
What are the key properties of bis(1-butoxyethyl) sulfate?
bis(1-butoxyethyl) sulfate has a molecular weight of 298.40 g/mol, XLogP of 2.59, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-butoxyethyl) sulfate is sourced from PubChem (CID 88713543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).